About 5-N-(2,2-dimethylcyclohexyl)isoquinoline-5,8-diamine
5-N-(2,2-dimethylcyclohexyl)isoquinoline-5,8-diamine (PubChem CID 79861810) has the molecular formula C17H23N3
and a molecular weight of 269.39 g/mol. Its IUPAC name is 5-N-(2,2-dimethylcyclohexyl)isoquinoline-5,8-diamine.
Molecular Properties
| Compound Name | 5-N-(2,2-dimethylcyclohexyl)isoquinoline-5,8-diamine |
| PubChem CID | 79861810 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 5-N-(2,2-dimethylcyclohexyl)isoquinoline-5,8-diamine |
| SMILES | CC1(C)CCCCC1Nc1ccc(N)c2cnccc12 |
| InChI | InChI=1S/C17H23N3/c1-17(2)9-4-3-5-16(17)20-15-7-6-14(18)13-11-19-10-8-12(13)15/h6-8,10-11,16,20H,3-5,9,18H2,1-2H3 |
| InChIKey | KYLVHZSSAFIZGX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-N-(2,2-dimethylcyclohexyl)isoquinoline-5,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-(2,2-dimethylcyclohexyl)isoquinoline-5,8-diamine?
The IUPAC name of 5-N-(2,2-dimethylcyclohexyl)isoquinoline-5,8-diamine (CID 79861810) is 5-N-(2,2-dimethylcyclohexyl)isoquinoline-5,8-diamine.
What is the SMILES notation for 5-N-(2,2-dimethylcyclohexyl)isoquinoline-5,8-diamine?
The canonical SMILES for 5-N-(2,2-dimethylcyclohexyl)isoquinoline-5,8-diamine is CC1(C)CCCCC1Nc1ccc(N)c2cnccc12.
What is the InChIKey of 5-N-(2,2-dimethylcyclohexyl)isoquinoline-5,8-diamine?
The InChIKey is KYLVHZSSAFIZGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3/c1-17(2)9-4-3-5-16(17)20-15-7-6-14(18)13-11-19-10-8-12(13)15/h6-8,10-11,16,20H,3-5,9,18H2,1-2H3.
What are the key properties of 5-N-(2,2-dimethylcyclohexyl)isoquinoline-5,8-diamine?
5-N-(2,2-dimethylcyclohexyl)isoquinoline-5,8-diamine has a molecular weight of 269.39 g/mol, XLogP of 4.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-(2,2-dimethylcyclohexyl)isoquinoline-5,8-diamine is sourced from PubChem (CID 79861810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).