C16H20BrN3 — CID 79861972
6-bromo-4-N-(2,2-dimethylcyclopentyl)quinoline-3,4-diamine (PubChem CID 79861972) has the molecular formula C16H20BrN3 and a molecular weight of 334.26 g/mol. Its IUPAC name is 6-bromo-4-N-(2,2-dimethylcyclopentyl)quinoline-3,4-diamine.
| Compound Name | 6-bromo-4-N-(2,2-dimethylcyclopentyl)quinoline-3,4-diamine |
|---|---|
| PubChem CID | 79861972 |
| Molecular Formula | C16H20BrN3 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 6-bromo-4-N-(2,2-dimethylcyclopentyl)quinoline-3,4-diamine |
| SMILES | CC1(C)CCCC1Nc1c(N)cnc2ccc(Br)cc12 |
| InChI | InChI=1S/C16H20BrN3/c1-16(2)7-3-4-14(16)20-15-11-8-10(17)5-6-13(11)19-9-12(15)18/h5-6,8-9,14H,3-4,7,18H2,1-2H3,(H,19,20) |
| InChIKey | PWMJEBIPVPMIAS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |