About 2-[3,3-dimethyl-2-(methylamino)cyclopentyl]sulfanyl-1H-pyrimidin-6-one
2-[3,3-dimethyl-2-(methylamino)cyclopentyl]sulfanyl-1H-pyrimidin-6-one (PubChem CID 79863172) has the molecular formula C12H19N3OS
and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-[3,3-dimethyl-2-(methylamino)cyclopentyl]sulfanyl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-[3,3-dimethyl-2-(methylamino)cyclopentyl]sulfanyl-1H-pyrimidin-6-one |
| PubChem CID | 79863172 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-[3,3-dimethyl-2-(methylamino)cyclopentyl]sulfanyl-1H-pyrimidin-6-one |
| SMILES | CNC1C(Sc2nccc(=O)[nH]2)CCC1(C)C |
| InChI | InChI=1S/C12H19N3OS/c1-12(2)6-4-8(10(12)13-3)17-11-14-7-5-9(16)15-11/h5,7-8,10,13H,4,6H2,1-3H3,(H,14,15,16) |
| InChIKey | KTGJTXJRXFUALD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3,3-dimethyl-2-(methylamino)cyclopentyl]sulfanyl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,3-dimethyl-2-(methylamino)cyclopentyl]sulfanyl-1H-pyrimidin-6-one?
The IUPAC name of 2-[3,3-dimethyl-2-(methylamino)cyclopentyl]sulfanyl-1H-pyrimidin-6-one (CID 79863172) is 2-[3,3-dimethyl-2-(methylamino)cyclopentyl]sulfanyl-1H-pyrimidin-6-one.
What is the SMILES notation for 2-[3,3-dimethyl-2-(methylamino)cyclopentyl]sulfanyl-1H-pyrimidin-6-one?
The canonical SMILES for 2-[3,3-dimethyl-2-(methylamino)cyclopentyl]sulfanyl-1H-pyrimidin-6-one is CNC1C(Sc2nccc(=O)[nH]2)CCC1(C)C.
What is the InChIKey of 2-[3,3-dimethyl-2-(methylamino)cyclopentyl]sulfanyl-1H-pyrimidin-6-one?
The InChIKey is KTGJTXJRXFUALD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3OS/c1-12(2)6-4-8(10(12)13-3)17-11-14-7-5-9(16)15-11/h5,7-8,10,13H,4,6H2,1-3H3,(H,14,15,16).
What are the key properties of 2-[3,3-dimethyl-2-(methylamino)cyclopentyl]sulfanyl-1H-pyrimidin-6-one?
2-[3,3-dimethyl-2-(methylamino)cyclopentyl]sulfanyl-1H-pyrimidin-6-one has a molecular weight of 253.37 g/mol, XLogP of 1.64, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,3-dimethyl-2-(methylamino)cyclopentyl]sulfanyl-1H-pyrimidin-6-one is sourced from PubChem (CID 79863172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).