C9H10NO5S- — CID 7986332
2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 7986332) has the molecular formula C9H10NO5S- and a molecular weight of 244.25 g/mol. Its IUPAC name is 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 7986332 |
| Molecular Formula | C9H10NO5S- |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOC(=O)/C=C1\SCC(=O)N1CC(=O)[O-] |
| InChI | InChI=1S/C9H11NO5S/c1-2-15-9(14)3-7-10(4-8(12)13)6(11)5-16-7/h3H,2,4-5H2,1H3,(H,12,13)/p-1/b7-3- |
| InChIKey | LKIZGGQUGGEKEA-CLTKARDFSA-M |
| XLogP | -1.28 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|