About 2-amino-N-cyclopropyl-4,4-dimethyl-5,6-dihydrocyclopenta[b]thiophene-3-carboxamide
2-amino-N-cyclopropyl-4,4-dimethyl-5,6-dihydrocyclopenta[b]thiophene-3-carboxamide (PubChem CID 79864013) has the molecular formula C13H18N2OS
and a molecular weight of 250.37 g/mol. Its IUPAC name is 2-amino-N-cyclopropyl-4,4-dimethyl-5,6-dihydrocyclopenta[b]thiophene-3-carboxamide.
Molecular Properties
| Compound Name | 2-amino-N-cyclopropyl-4,4-dimethyl-5,6-dihydrocyclopenta[b]thiophene-3-carboxamide |
| PubChem CID | 79864013 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-amino-N-cyclopropyl-4,4-dimethyl-5,6-dihydrocyclopenta[b]thiophene-3-carboxamide |
| SMILES | CC1(C)CCc2sc(N)c(C(=O)NC3CC3)c21 |
| InChI | InChI=1S/C13H18N2OS/c1-13(2)6-5-8-10(13)9(11(14)17-8)12(16)15-7-3-4-7/h7H,3-6,14H2,1-2H3,(H,15,16) |
| InChIKey | ROVPKHHZBVTNOU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-cyclopropyl-4,4-dimethyl-5,6-dihydrocyclopenta[b]thiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-cyclopropyl-4,4-dimethyl-5,6-dihydrocyclopenta[b]thiophene-3-carboxamide?
The IUPAC name of 2-amino-N-cyclopropyl-4,4-dimethyl-5,6-dihydrocyclopenta[b]thiophene-3-carboxamide (CID 79864013) is 2-amino-N-cyclopropyl-4,4-dimethyl-5,6-dihydrocyclopenta[b]thiophene-3-carboxamide.
What is the SMILES notation for 2-amino-N-cyclopropyl-4,4-dimethyl-5,6-dihydrocyclopenta[b]thiophene-3-carboxamide?
The canonical SMILES for 2-amino-N-cyclopropyl-4,4-dimethyl-5,6-dihydrocyclopenta[b]thiophene-3-carboxamide is CC1(C)CCc2sc(N)c(C(=O)NC3CC3)c21.
What is the InChIKey of 2-amino-N-cyclopropyl-4,4-dimethyl-5,6-dihydrocyclopenta[b]thiophene-3-carboxamide?
The InChIKey is ROVPKHHZBVTNOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2OS/c1-13(2)6-5-8-10(13)9(11(14)17-8)12(16)15-7-3-4-7/h7H,3-6,14H2,1-2H3,(H,15,16).
What are the key properties of 2-amino-N-cyclopropyl-4,4-dimethyl-5,6-dihydrocyclopenta[b]thiophene-3-carboxamide?
2-amino-N-cyclopropyl-4,4-dimethyl-5,6-dihydrocyclopenta[b]thiophene-3-carboxamide has a molecular weight of 250.37 g/mol, XLogP of 2.45, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-cyclopropyl-4,4-dimethyl-5,6-dihydrocyclopenta[b]thiophene-3-carboxamide is sourced from PubChem (CID 79864013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).