C21H23NO3S — CID 7986649
(2R)-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide (PubChem CID 7986649) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is (2R)-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide.
| Compound Name | (2R)-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide |
|---|---|
| PubChem CID | 7986649 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (2R)-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide |
| SMILES | C[C@@H](Sc1ccc2c(c1)OCCO2)C(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C21H23NO3S/c1-14(26-16-9-10-19-20(13-16)25-12-11-24-19)21(23)22-18-8-4-6-15-5-2-3-7-17(15)18/h2-3,5,7,9-10,13-14,18H,4,6,8,11-12H2,1H3,(H,22,23)/t14-,18-/m1/s1 |
| InChIKey | PVQRLETUPWMEFU-RDTXWAMCSA-N |
| XLogP | 4.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |