About 2-tert-butyl-4,4-dimethyl-5,6-dihydrocyclopenta[c]pyrazol-3-amine
2-tert-butyl-4,4-dimethyl-5,6-dihydrocyclopenta[c]pyrazol-3-amine (PubChem CID 79866632) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-tert-butyl-4,4-dimethyl-5,6-dihydrocyclopenta[c]pyrazol-3-amine.
Molecular Properties
| Compound Name | 2-tert-butyl-4,4-dimethyl-5,6-dihydrocyclopenta[c]pyrazol-3-amine |
| PubChem CID | 79866632 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 2-tert-butyl-4,4-dimethyl-5,6-dihydrocyclopenta[c]pyrazol-3-amine |
| SMILES | CC1(C)CCc2nn(C(C)(C)C)c(N)c21 |
| InChI | InChI=1S/C12H21N3/c1-11(2,3)15-10(13)9-8(14-15)6-7-12(9,4)5/h6-7,13H2,1-5H3 |
| InChIKey | WHBWSIJFJQXGFK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-4,4-dimethyl-5,6-dihydrocyclopenta[c]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4,4-dimethyl-5,6-dihydrocyclopenta[c]pyrazol-3-amine?
The IUPAC name of 2-tert-butyl-4,4-dimethyl-5,6-dihydrocyclopenta[c]pyrazol-3-amine (CID 79866632) is 2-tert-butyl-4,4-dimethyl-5,6-dihydrocyclopenta[c]pyrazol-3-amine.
What is the SMILES notation for 2-tert-butyl-4,4-dimethyl-5,6-dihydrocyclopenta[c]pyrazol-3-amine?
The canonical SMILES for 2-tert-butyl-4,4-dimethyl-5,6-dihydrocyclopenta[c]pyrazol-3-amine is CC1(C)CCc2nn(C(C)(C)C)c(N)c21.
What is the InChIKey of 2-tert-butyl-4,4-dimethyl-5,6-dihydrocyclopenta[c]pyrazol-3-amine?
The InChIKey is WHBWSIJFJQXGFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3/c1-11(2,3)15-10(13)9-8(14-15)6-7-12(9,4)5/h6-7,13H2,1-5H3.
What are the key properties of 2-tert-butyl-4,4-dimethyl-5,6-dihydrocyclopenta[c]pyrazol-3-amine?
2-tert-butyl-4,4-dimethyl-5,6-dihydrocyclopenta[c]pyrazol-3-amine has a molecular weight of 207.32 g/mol, XLogP of 2.44, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4,4-dimethyl-5,6-dihydrocyclopenta[c]pyrazol-3-amine is sourced from PubChem (CID 79866632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).