About 2-(aminomethyl)-5,5-dimethyl-2-(2-phenylsulfanylethyl)cyclopentan-1-ol
2-(aminomethyl)-5,5-dimethyl-2-(2-phenylsulfanylethyl)cyclopentan-1-ol (PubChem CID 79866781) has the molecular formula C16H25NOS
and a molecular weight of 279.45 g/mol. Its IUPAC name is 2-(aminomethyl)-5,5-dimethyl-2-(2-phenylsulfanylethyl)cyclopentan-1-ol.
Molecular Properties
| Compound Name | 2-(aminomethyl)-5,5-dimethyl-2-(2-phenylsulfanylethyl)cyclopentan-1-ol |
| PubChem CID | 79866781 |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 2-(aminomethyl)-5,5-dimethyl-2-(2-phenylsulfanylethyl)cyclopentan-1-ol |
| SMILES | CC1(C)CCC(CN)(CCSc2ccccc2)C1O |
| InChI | InChI=1S/C16H25NOS/c1-15(2)8-9-16(12-17,14(15)18)10-11-19-13-6-4-3-5-7-13/h3-7,14,18H,8-12,17H2,1-2H3 |
| InChIKey | NELUNWJIMDORRH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(aminomethyl)-5,5-dimethyl-2-(2-phenylsulfanylethyl)cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-5,5-dimethyl-2-(2-phenylsulfanylethyl)cyclopentan-1-ol?
The IUPAC name of 2-(aminomethyl)-5,5-dimethyl-2-(2-phenylsulfanylethyl)cyclopentan-1-ol (CID 79866781) is 2-(aminomethyl)-5,5-dimethyl-2-(2-phenylsulfanylethyl)cyclopentan-1-ol.
What is the SMILES notation for 2-(aminomethyl)-5,5-dimethyl-2-(2-phenylsulfanylethyl)cyclopentan-1-ol?
The canonical SMILES for 2-(aminomethyl)-5,5-dimethyl-2-(2-phenylsulfanylethyl)cyclopentan-1-ol is CC1(C)CCC(CN)(CCSc2ccccc2)C1O.
What is the InChIKey of 2-(aminomethyl)-5,5-dimethyl-2-(2-phenylsulfanylethyl)cyclopentan-1-ol?
The InChIKey is NELUNWJIMDORRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NOS/c1-15(2)8-9-16(12-17,14(15)18)10-11-19-13-6-4-3-5-7-13/h3-7,14,18H,8-12,17H2,1-2H3.
What are the key properties of 2-(aminomethyl)-5,5-dimethyl-2-(2-phenylsulfanylethyl)cyclopentan-1-ol?
2-(aminomethyl)-5,5-dimethyl-2-(2-phenylsulfanylethyl)cyclopentan-1-ol has a molecular weight of 279.45 g/mol, XLogP of 3.29, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-5,5-dimethyl-2-(2-phenylsulfanylethyl)cyclopentan-1-ol is sourced from PubChem (CID 79866781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).