About 3-methyl-1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidin-4-amine
3-methyl-1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidin-4-amine (PubChem CID 79867718) has the molecular formula C13H18N4O2S
and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-methyl-1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidin-4-amine.
Molecular Properties
| Compound Name | 3-methyl-1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidin-4-amine |
| PubChem CID | 79867718 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 3-methyl-1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidin-4-amine |
| SMILES | CC1CN(S(=O)(=O)c2c[nH]c3ncccc23)CCC1N |
| InChI | InChI=1S/C13H18N4O2S/c1-9-8-17(6-4-11(9)14)20(18,19)12-7-16-13-10(12)3-2-5-15-13/h2-3,5,7,9,11H,4,6,8,14H2,1H3,(H,15,16) |
| InChIKey | LKPBWNINMMMGHT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidin-4-amine?
The IUPAC name of 3-methyl-1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidin-4-amine (CID 79867718) is 3-methyl-1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidin-4-amine.
What is the SMILES notation for 3-methyl-1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidin-4-amine?
The canonical SMILES for 3-methyl-1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidin-4-amine is CC1CN(S(=O)(=O)c2c[nH]c3ncccc23)CCC1N.
What is the InChIKey of 3-methyl-1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidin-4-amine?
The InChIKey is LKPBWNINMMMGHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O2S/c1-9-8-17(6-4-11(9)14)20(18,19)12-7-16-13-10(12)3-2-5-15-13/h2-3,5,7,9,11H,4,6,8,14H2,1H3,(H,15,16).
What are the key properties of 3-methyl-1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidin-4-amine?
3-methyl-1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidin-4-amine has a molecular weight of 294.38 g/mol, XLogP of 0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperidin-4-amine is sourced from PubChem (CID 79867718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).