C16H25ClN4 — CID 79870294
5-(1-chloroethyl)-6-(2,2-dimethylcyclopentyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazole (PubChem CID 79870294) has the molecular formula C16H25ClN4 and a molecular weight of 308.86 g/mol. Its IUPAC name is 5-(1-chloroethyl)-6-(2,2-dimethylcyclopentyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazole.
| Compound Name | 5-(1-chloroethyl)-6-(2,2-dimethylcyclopentyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 79870294 |
| Molecular Formula | C16H25ClN4 |
| Molecular Weight | 308.86 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 5-(1-chloroethyl)-6-(2,2-dimethylcyclopentyl)-3-ethyl-1-methylimidazo[4,5-d]pyrazole |
| SMILES | CCc1nn(C)c2c1nc(C(C)Cl)n2C1CCCC1(C)C |
| InChI | InChI=1S/C16H25ClN4/c1-6-11-13-15(20(5)19-11)21(14(18-13)10(2)17)12-8-7-9-16(12,3)4/h10,12H,6-9H2,1-5H3 |
| InChIKey | AXJPZNIRFQHDDR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.86 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|