C15H24N2O4 — CID 79870653
4-[(2,2-dimethylcyclohexyl)carbamoylamino]-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 79870653) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-[(2,2-dimethylcyclohexyl)carbamoylamino]-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-[(2,2-dimethylcyclohexyl)carbamoylamino]-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 79870653 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 4-[(2,2-dimethylcyclohexyl)carbamoylamino]-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)NC(=O)NC1CCCCC1(C)C |
| InChI | InChI=1S/C15H24N2O4/c1-9(10(2)13(19)20)12(18)17-14(21)16-11-7-5-6-8-15(11,3)4/h11H,5-8H2,1-4H3,(H,19,20)(H2,16,17,18,21) |
| InChIKey | FRWZEEYXGJUVGY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|