C17H23NO2S — CID 79870685
N-(2,2-dimethylcyclohexyl)-3-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide (PubChem CID 79870685) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is N-(2,2-dimethylcyclohexyl)-3-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide.
| Compound Name | N-(2,2-dimethylcyclohexyl)-3-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 79870685 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-(2,2-dimethylcyclohexyl)-3-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide |
| SMILES | CC1(C)CCCCC1NC(=O)c1sccc1C#CCCO |
| InChI | InChI=1S/C17H23NO2S/c1-17(2)10-5-3-8-14(17)18-16(20)15-13(9-12-21-15)7-4-6-11-19/h9,12,14,19H,3,5-6,8,10-11H2,1-2H3,(H,18,20) |
| InChIKey | CGRFNUJDOIKEGO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|