C16H25ClN4 — CID 79871224
5-(2-chloroethyl)-6-(2,2-dimethylcyclohexyl)-1,3-dimethylimidazo[4,5-d]pyrazole (PubChem CID 79871224) has the molecular formula C16H25ClN4 and a molecular weight of 308.86 g/mol. Its IUPAC name is 5-(2-chloroethyl)-6-(2,2-dimethylcyclohexyl)-1,3-dimethylimidazo[4,5-d]pyrazole.
| Compound Name | 5-(2-chloroethyl)-6-(2,2-dimethylcyclohexyl)-1,3-dimethylimidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 79871224 |
| Molecular Formula | C16H25ClN4 |
| Molecular Weight | 308.86 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 5-(2-chloroethyl)-6-(2,2-dimethylcyclohexyl)-1,3-dimethylimidazo[4,5-d]pyrazole |
| SMILES | Cc1nn(C)c2c1nc(CCCl)n2C1CCCCC1(C)C |
| InChI | InChI=1S/C16H25ClN4/c1-11-14-15(20(4)19-11)21(13(18-14)8-10-17)12-7-5-6-9-16(12,2)3/h12H,5-10H2,1-4H3 |
| InChIKey | NXVFWZBSPQMOIL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.86 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|