C15H18ClFN2 — CID 79871475
2-(chloromethyl)-1-(2,2-dimethylcyclopentyl)-5-fluorobenzimidazole (PubChem CID 79871475) has the molecular formula C15H18ClFN2 and a molecular weight of 280.77 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(2,2-dimethylcyclopentyl)-5-fluorobenzimidazole.
| Compound Name | 2-(chloromethyl)-1-(2,2-dimethylcyclopentyl)-5-fluorobenzimidazole |
|---|---|
| PubChem CID | 79871475 |
| Molecular Formula | C15H18ClFN2 |
| Molecular Weight | 280.77 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-(chloromethyl)-1-(2,2-dimethylcyclopentyl)-5-fluorobenzimidazole |
| SMILES | CC1(C)CCCC1n1c(CCl)nc2cc(F)ccc21 |
| InChI | InChI=1S/C15H18ClFN2/c1-15(2)7-3-4-13(15)19-12-6-5-10(17)8-11(12)18-14(19)9-16/h5-6,8,13H,3-4,7,9H2,1-2H3 |
| InChIKey | RCRSHLVIOZPPIC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.77 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|