About 5-ethoxy-2-ethyl-1,2,4-triazol-3-amine
5-ethoxy-2-ethyl-1,2,4-triazol-3-amine (PubChem CID 79872612) has the molecular formula C6H12N4O
and a molecular weight of 156.19 g/mol. Its IUPAC name is 5-ethoxy-2-ethyl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-ethoxy-2-ethyl-1,2,4-triazol-3-amine |
| PubChem CID | 79872612 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 5-ethoxy-2-ethyl-1,2,4-triazol-3-amine |
| SMILES | CCOc1nc(N)n(CC)n1 |
| InChI | InChI=1S/C6H12N4O/c1-3-10-5(7)8-6(9-10)11-4-2/h3-4H2,1-2H3,(H2,7,8,9) |
| InChIKey | MRMNDAKSWIDAAV-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-ethoxy-2-ethyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-2-ethyl-1,2,4-triazol-3-amine?
The IUPAC name of 5-ethoxy-2-ethyl-1,2,4-triazol-3-amine (CID 79872612) is 5-ethoxy-2-ethyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-ethoxy-2-ethyl-1,2,4-triazol-3-amine?
The canonical SMILES for 5-ethoxy-2-ethyl-1,2,4-triazol-3-amine is CCOc1nc(N)n(CC)n1.
What is the InChIKey of 5-ethoxy-2-ethyl-1,2,4-triazol-3-amine?
The InChIKey is MRMNDAKSWIDAAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O/c1-3-10-5(7)8-6(9-10)11-4-2/h3-4H2,1-2H3,(H2,7,8,9).
What are the key properties of 5-ethoxy-2-ethyl-1,2,4-triazol-3-amine?
5-ethoxy-2-ethyl-1,2,4-triazol-3-amine has a molecular weight of 156.19 g/mol, XLogP of 0.28, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-2-ethyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 79872612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).