About 4-amino-N-(2,2-dimethylcyclohexyl)-3,5-difluorobenzamide
4-amino-N-(2,2-dimethylcyclohexyl)-3,5-difluorobenzamide (PubChem CID 79872681) has the molecular formula C15H20F2N2O
and a molecular weight of 282.33 g/mol. Its IUPAC name is 4-amino-N-(2,2-dimethylcyclohexyl)-3,5-difluorobenzamide.
Molecular Properties
| Compound Name | 4-amino-N-(2,2-dimethylcyclohexyl)-3,5-difluorobenzamide |
| PubChem CID | 79872681 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-amino-N-(2,2-dimethylcyclohexyl)-3,5-difluorobenzamide |
| SMILES | CC1(C)CCCCC1NC(=O)c1cc(F)c(N)c(F)c1 |
| InChI | InChI=1S/C15H20F2N2O/c1-15(2)6-4-3-5-12(15)19-14(20)9-7-10(16)13(18)11(17)8-9/h7-8,12H,3-6,18H2,1-2H3,(H,19,20) |
| InChIKey | MRHCNJORDLJPET-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-(2,2-dimethylcyclohexyl)-3,5-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(2,2-dimethylcyclohexyl)-3,5-difluorobenzamide?
The IUPAC name of 4-amino-N-(2,2-dimethylcyclohexyl)-3,5-difluorobenzamide (CID 79872681) is 4-amino-N-(2,2-dimethylcyclohexyl)-3,5-difluorobenzamide.
What is the SMILES notation for 4-amino-N-(2,2-dimethylcyclohexyl)-3,5-difluorobenzamide?
The canonical SMILES for 4-amino-N-(2,2-dimethylcyclohexyl)-3,5-difluorobenzamide is CC1(C)CCCCC1NC(=O)c1cc(F)c(N)c(F)c1.
What is the InChIKey of 4-amino-N-(2,2-dimethylcyclohexyl)-3,5-difluorobenzamide?
The InChIKey is MRHCNJORDLJPET-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F2N2O/c1-15(2)6-4-3-5-12(15)19-14(20)9-7-10(16)13(18)11(17)8-9/h7-8,12H,3-6,18H2,1-2H3,(H,19,20).
What are the key properties of 4-amino-N-(2,2-dimethylcyclohexyl)-3,5-difluorobenzamide?
4-amino-N-(2,2-dimethylcyclohexyl)-3,5-difluorobenzamide has a molecular weight of 282.33 g/mol, XLogP of 3.25, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(2,2-dimethylcyclohexyl)-3,5-difluorobenzamide is sourced from PubChem (CID 79872681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).