About 2-cyclohexyl-5-methoxy-1,2,4-triazol-3-amine
2-cyclohexyl-5-methoxy-1,2,4-triazol-3-amine (PubChem CID 79872890) has the molecular formula C9H16N4O
and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-cyclohexyl-5-methoxy-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 2-cyclohexyl-5-methoxy-1,2,4-triazol-3-amine |
| PubChem CID | 79872890 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2-cyclohexyl-5-methoxy-1,2,4-triazol-3-amine |
| SMILES | COc1nc(N)n(C2CCCCC2)n1 |
| InChI | InChI=1S/C9H16N4O/c1-14-9-11-8(10)13(12-9)7-5-3-2-4-6-7/h7H,2-6H2,1H3,(H2,10,11,12) |
| InChIKey | OYQQNEWFMMDEAN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclohexyl-5-methoxy-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-5-methoxy-1,2,4-triazol-3-amine?
The IUPAC name of 2-cyclohexyl-5-methoxy-1,2,4-triazol-3-amine (CID 79872890) is 2-cyclohexyl-5-methoxy-1,2,4-triazol-3-amine.
What is the SMILES notation for 2-cyclohexyl-5-methoxy-1,2,4-triazol-3-amine?
The canonical SMILES for 2-cyclohexyl-5-methoxy-1,2,4-triazol-3-amine is COc1nc(N)n(C2CCCCC2)n1.
What is the InChIKey of 2-cyclohexyl-5-methoxy-1,2,4-triazol-3-amine?
The InChIKey is OYQQNEWFMMDEAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O/c1-14-9-11-8(10)13(12-9)7-5-3-2-4-6-7/h7H,2-6H2,1H3,(H2,10,11,12).
What are the key properties of 2-cyclohexyl-5-methoxy-1,2,4-triazol-3-amine?
2-cyclohexyl-5-methoxy-1,2,4-triazol-3-amine has a molecular weight of 196.25 g/mol, XLogP of 1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-5-methoxy-1,2,4-triazol-3-amine is sourced from PubChem (CID 79872890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).