C15H22ClN3O — CID 79872955
2-chloro-N-(2,2-dimethylcyclopentyl)-6-(ethylamino)pyridine-4-carboxamide (PubChem CID 79872955) has the molecular formula C15H22ClN3O and a molecular weight of 295.81 g/mol. Its IUPAC name is 2-chloro-N-(2,2-dimethylcyclopentyl)-6-(ethylamino)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(2,2-dimethylcyclopentyl)-6-(ethylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 79872955 |
| Molecular Formula | C15H22ClN3O |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 2-chloro-N-(2,2-dimethylcyclopentyl)-6-(ethylamino)pyridine-4-carboxamide |
| SMILES | CCNc1cc(C(=O)NC2CCCC2(C)C)cc(Cl)n1 |
| InChI | InChI=1S/C15H22ClN3O/c1-4-17-13-9-10(8-12(16)19-13)14(20)18-11-6-5-7-15(11,2)3/h8-9,11H,4-7H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | OAUGACMWAHYHTA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|