About 5-methoxy-2-phenyl-1,2,4-triazol-3-amine
5-methoxy-2-phenyl-1,2,4-triazol-3-amine (PubChem CID 79873453) has the molecular formula C9H10N4O
and a molecular weight of 190.21 g/mol. Its IUPAC name is 5-methoxy-2-phenyl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-methoxy-2-phenyl-1,2,4-triazol-3-amine |
| PubChem CID | 79873453 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 5-methoxy-2-phenyl-1,2,4-triazol-3-amine |
| SMILES | COc1nc(N)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C9H10N4O/c1-14-9-11-8(10)13(12-9)7-5-3-2-4-6-7/h2-6H,1H3,(H2,10,11,12) |
| InChIKey | FTDAFBSUKWCCSZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methoxy-2-phenyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-phenyl-1,2,4-triazol-3-amine?
The IUPAC name of 5-methoxy-2-phenyl-1,2,4-triazol-3-amine (CID 79873453) is 5-methoxy-2-phenyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-methoxy-2-phenyl-1,2,4-triazol-3-amine?
The canonical SMILES for 5-methoxy-2-phenyl-1,2,4-triazol-3-amine is COc1nc(N)n(-c2ccccc2)n1.
What is the InChIKey of 5-methoxy-2-phenyl-1,2,4-triazol-3-amine?
The InChIKey is FTDAFBSUKWCCSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O/c1-14-9-11-8(10)13(12-9)7-5-3-2-4-6-7/h2-6H,1H3,(H2,10,11,12).
What are the key properties of 5-methoxy-2-phenyl-1,2,4-triazol-3-amine?
5-methoxy-2-phenyl-1,2,4-triazol-3-amine has a molecular weight of 190.21 g/mol, XLogP of 0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-phenyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 79873453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).