About 3-(5-cyano-2,4-dioxopyrimidin-1-yl)propanamide
3-(5-cyano-2,4-dioxopyrimidin-1-yl)propanamide (PubChem CID 79874209) has the molecular formula C8H8N4O3
and a molecular weight of 208.18 g/mol. Its IUPAC name is 3-(5-cyano-2,4-dioxopyrimidin-1-yl)propanamide.
Molecular Properties
| Compound Name | 3-(5-cyano-2,4-dioxopyrimidin-1-yl)propanamide |
| PubChem CID | 79874209 |
| Molecular Formula | C8H8N4O3 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 3-(5-cyano-2,4-dioxopyrimidin-1-yl)propanamide |
| SMILES | N#Cc1cn(CCC(N)=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H8N4O3/c9-3-5-4-12(2-1-6(10)13)8(15)11-7(5)14/h4H,1-2H2,(H2,10,13)(H,11,14,15) |
| InChIKey | FYLXFWHWMYUIPD-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 121.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(5-cyano-2,4-dioxopyrimidin-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-cyano-2,4-dioxopyrimidin-1-yl)propanamide?
The IUPAC name of 3-(5-cyano-2,4-dioxopyrimidin-1-yl)propanamide (CID 79874209) is 3-(5-cyano-2,4-dioxopyrimidin-1-yl)propanamide.
What is the SMILES notation for 3-(5-cyano-2,4-dioxopyrimidin-1-yl)propanamide?
The canonical SMILES for 3-(5-cyano-2,4-dioxopyrimidin-1-yl)propanamide is N#Cc1cn(CCC(N)=O)c(=O)[nH]c1=O.
What is the InChIKey of 3-(5-cyano-2,4-dioxopyrimidin-1-yl)propanamide?
The InChIKey is FYLXFWHWMYUIPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O3/c9-3-5-4-12(2-1-6(10)13)8(15)11-7(5)14/h4H,1-2H2,(H2,10,13)(H,11,14,15).
What are the key properties of 3-(5-cyano-2,4-dioxopyrimidin-1-yl)propanamide?
3-(5-cyano-2,4-dioxopyrimidin-1-yl)propanamide has a molecular weight of 208.18 g/mol, XLogP of -1.72, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-cyano-2,4-dioxopyrimidin-1-yl)propanamide is sourced from PubChem (CID 79874209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).