C13H18N4O2 — CID 79874659
2,4-dioxo-1-(1-propylpiperidin-4-yl)pyrimidine-5-carbonitrile (PubChem CID 79874659) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2,4-dioxo-1-(1-propylpiperidin-4-yl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-dioxo-1-(1-propylpiperidin-4-yl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 79874659 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2,4-dioxo-1-(1-propylpiperidin-4-yl)pyrimidine-5-carbonitrile |
| SMILES | CCCN1CCC(n2cc(C#N)c(=O)[nH]c2=O)CC1 |
| InChI | InChI=1S/C13H18N4O2/c1-2-5-16-6-3-11(4-7-16)17-9-10(8-14)12(18)15-13(17)19/h9,11H,2-7H2,1H3,(H,15,18,19) |
| InChIKey | YUDVJUCNGYZGHD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |