About 2,4-dioxo-1-[2-(1,3-thiazol-4-yl)ethyl]pyrimidine-5-carboxylic acid
2,4-dioxo-1-[2-(1,3-thiazol-4-yl)ethyl]pyrimidine-5-carboxylic acid (PubChem CID 79874897) has the molecular formula C10H9N3O4S
and a molecular weight of 267.27 g/mol. Its IUPAC name is 2,4-dioxo-1-[2-(1,3-thiazol-4-yl)ethyl]pyrimidine-5-carboxylic acid.
Molecular Properties
| Compound Name | 2,4-dioxo-1-[2-(1,3-thiazol-4-yl)ethyl]pyrimidine-5-carboxylic acid |
| PubChem CID | 79874897 |
| Molecular Formula | C10H9N3O4S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 2,4-dioxo-1-[2-(1,3-thiazol-4-yl)ethyl]pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cn(CCc2cscn2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H9N3O4S/c14-8-7(9(15)16)3-13(10(17)12-8)2-1-6-4-18-5-11-6/h3-5H,1-2H2,(H,15,16)(H,12,14,17) |
| InChIKey | SDXKDQUZMGTAFZ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,4-dioxo-1-[2-(1,3-thiazol-4-yl)ethyl]pyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dioxo-1-[2-(1,3-thiazol-4-yl)ethyl]pyrimidine-5-carboxylic acid?
The IUPAC name of 2,4-dioxo-1-[2-(1,3-thiazol-4-yl)ethyl]pyrimidine-5-carboxylic acid (CID 79874897) is 2,4-dioxo-1-[2-(1,3-thiazol-4-yl)ethyl]pyrimidine-5-carboxylic acid.
What is the SMILES notation for 2,4-dioxo-1-[2-(1,3-thiazol-4-yl)ethyl]pyrimidine-5-carboxylic acid?
The canonical SMILES for 2,4-dioxo-1-[2-(1,3-thiazol-4-yl)ethyl]pyrimidine-5-carboxylic acid is O=C(O)c1cn(CCc2cscn2)c(=O)[nH]c1=O.
What is the InChIKey of 2,4-dioxo-1-[2-(1,3-thiazol-4-yl)ethyl]pyrimidine-5-carboxylic acid?
The InChIKey is SDXKDQUZMGTAFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O4S/c14-8-7(9(15)16)3-13(10(17)12-8)2-1-6-4-18-5-11-6/h3-5H,1-2H2,(H,15,16)(H,12,14,17).
What are the key properties of 2,4-dioxo-1-[2-(1,3-thiazol-4-yl)ethyl]pyrimidine-5-carboxylic acid?
2,4-dioxo-1-[2-(1,3-thiazol-4-yl)ethyl]pyrimidine-5-carboxylic acid has a molecular weight of 267.27 g/mol, XLogP of -0.07, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dioxo-1-[2-(1,3-thiazol-4-yl)ethyl]pyrimidine-5-carboxylic acid is sourced from PubChem (CID 79874897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).