C11H12N2O5S — CID 79875264
4-amino-2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)benzoic acid (PubChem CID 79875264) has the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. Its IUPAC name is 4-amino-2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)benzoic acid.
| Compound Name | 4-amino-2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)benzoic acid |
|---|---|
| PubChem CID | 79875264 |
| Molecular Formula | C11H12N2O5S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 4-amino-2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)benzoic acid |
| SMILES | CC1(C)C(=O)N(c2cc(N)ccc2C(=O)O)S1(=O)=O |
| InChI | InChI=1S/C11H12N2O5S/c1-11(2)10(16)13(19(11,17)18)8-5-6(12)3-4-7(8)9(14)15/h3-5H,12H2,1-2H3,(H,14,15) |
| InChIKey | STKJHKCMNKKLIL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|