About 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)acetic acid
2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)acetic acid (PubChem CID 79875266) has the molecular formula C6H9NO5S
and a molecular weight of 207.21 g/mol. Its IUPAC name is 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)acetic acid.
Analyze 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)acetic acid?
The IUPAC name of 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)acetic acid (CID 79875266) is 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)acetic acid.
What is the SMILES notation for 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)acetic acid?
The canonical SMILES for 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)acetic acid is CC1(C)C(=O)N(CC(=O)O)S1(=O)=O.
What is the InChIKey of 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)acetic acid?
The InChIKey is APKMCSBKWXVXCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO5S/c1-6(2)5(10)7(3-4(8)9)13(6,11)12/h3H2,1-2H3,(H,8,9).
What are the key properties of 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)acetic acid?
2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)acetic acid has a molecular weight of 207.21 g/mol, XLogP of -0.98, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)acetic acid is sourced from PubChem (CID 79875266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).