2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)hexanoic acid

C10H17NO5S — CID 79875267

IUPAC2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)hexanoic acid
SMILESCCCCC(C(=O)O)N1C(=O)C(C)(C)S1(=O)=O
InChIInChI=1S/C10H17NO5S/c1-4-5-6-7(8(12)13)11-9(14)10(2,3)17(11,15)16/h7H,4-6H2,1-3H3,(H,12,13)
InChIKeyMPBQSRZXSFMHDU-UHFFFAOYSA-N
MW263.31 g/mol
LogP0.58
Rot. Bonds5

About 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)hexanoic acid

2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)hexanoic acid (PubChem CID 79875267) has the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. Its IUPAC name is 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)hexanoic acid.

Molecular Properties

Compound Name2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)hexanoic acid
PubChem CID79875267
Molecular FormulaC10H17NO5S
Molecular Weight263.31 g/mol
Exact Mass263.08
IUPAC Name2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)hexanoic acid
SMILESCCCCC(C(=O)O)N1C(=O)C(C)(C)S1(=O)=O
InChIInChI=1S/C10H17NO5S/c1-4-5-6-7(8(12)13)11-9(14)10(2,3)17(11,15)16/h7H,4-6H2,1-3H3,(H,12,13)
InChIKeyMPBQSRZXSFMHDU-UHFFFAOYSA-N
XLogP0.58
TPSA91.75 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.31
LogP ≤ 50.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)hexanoic acid?
The IUPAC name of 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)hexanoic acid (CID 79875267) is 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)hexanoic acid.
What is the SMILES notation for 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)hexanoic acid?
The canonical SMILES for 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)hexanoic acid is CCCCC(C(=O)O)N1C(=O)C(C)(C)S1(=O)=O.
What is the InChIKey of 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)hexanoic acid?
The InChIKey is MPBQSRZXSFMHDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO5S/c1-4-5-6-7(8(12)13)11-9(14)10(2,3)17(11,15)16/h7H,4-6H2,1-3H3,(H,12,13).
What are the key properties of 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)hexanoic acid?
2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)hexanoic acid has a molecular weight of 263.31 g/mol, XLogP of 0.58, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)hexanoic acid is sourced from PubChem (CID 79875267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).