About 4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)pentanoic acid
4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)pentanoic acid (PubChem CID 79875272) has the molecular formula C9H15NO5S
and a molecular weight of 249.29 g/mol. Its IUPAC name is 4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)pentanoic acid.
Analyze 4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)pentanoic acid?
The IUPAC name of 4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)pentanoic acid (CID 79875272) is 4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)pentanoic acid.
What is the SMILES notation for 4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)pentanoic acid?
The canonical SMILES for 4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)pentanoic acid is CC(CCC(=O)O)N1C(=O)C(C)(C)S1(=O)=O.
What is the InChIKey of 4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)pentanoic acid?
The InChIKey is JPONZXKVKUFOJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO5S/c1-6(4-5-7(11)12)10-8(13)9(2,3)16(10,14)15/h6H,4-5H2,1-3H3,(H,11,12).
What are the key properties of 4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)pentanoic acid?
4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)pentanoic acid has a molecular weight of 249.29 g/mol, XLogP of 0.19, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)pentanoic acid is sourced from PubChem (CID 79875272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).