C13H12F3N3OS — CID 79875294
2-(2-thiophen-3-ylethylamino)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 79875294) has the molecular formula C13H12F3N3OS and a molecular weight of 315.32 g/mol. Its IUPAC name is 2-(2-thiophen-3-ylethylamino)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-(2-thiophen-3-ylethylamino)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 79875294 |
| Molecular Formula | C13H12F3N3OS |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-(2-thiophen-3-ylethylamino)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(C(F)(F)F)nc1NCCc1ccsc1 |
| InChI | InChI=1S/C13H12F3N3OS/c14-13(15,16)10-2-1-9(11(17)20)12(19-10)18-5-3-8-4-6-21-7-8/h1-2,4,6-7H,3,5H2,(H2,17,20)(H,18,19) |
| InChIKey | WSLVLSBVDFGUEC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |