About 4,4-dimethyl-2-[(3-methylpiperidin-2-yl)methyl]-1,1-dioxothiazetidin-3-one
4,4-dimethyl-2-[(3-methylpiperidin-2-yl)methyl]-1,1-dioxothiazetidin-3-one (PubChem CID 79875634) has the molecular formula C11H20N2O3S
and a molecular weight of 260.36 g/mol. Its IUPAC name is 4,4-dimethyl-2-[(3-methylpiperidin-2-yl)methyl]-1,1-dioxothiazetidin-3-one.
Molecular Properties
| Compound Name | 4,4-dimethyl-2-[(3-methylpiperidin-2-yl)methyl]-1,1-dioxothiazetidin-3-one |
| PubChem CID | 79875634 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4,4-dimethyl-2-[(3-methylpiperidin-2-yl)methyl]-1,1-dioxothiazetidin-3-one |
| SMILES | CC1CCCNC1CN1C(=O)C(C)(C)S1(=O)=O |
| InChI | InChI=1S/C11H20N2O3S/c1-8-5-4-6-12-9(8)7-13-10(14)11(2,3)17(13,15)16/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | KRCONVBMZNXNNN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,4-dimethyl-2-[(3-methylpiperidin-2-yl)methyl]-1,1-dioxothiazetidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-2-[(3-methylpiperidin-2-yl)methyl]-1,1-dioxothiazetidin-3-one?
The IUPAC name of 4,4-dimethyl-2-[(3-methylpiperidin-2-yl)methyl]-1,1-dioxothiazetidin-3-one (CID 79875634) is 4,4-dimethyl-2-[(3-methylpiperidin-2-yl)methyl]-1,1-dioxothiazetidin-3-one.
What is the SMILES notation for 4,4-dimethyl-2-[(3-methylpiperidin-2-yl)methyl]-1,1-dioxothiazetidin-3-one?
The canonical SMILES for 4,4-dimethyl-2-[(3-methylpiperidin-2-yl)methyl]-1,1-dioxothiazetidin-3-one is CC1CCCNC1CN1C(=O)C(C)(C)S1(=O)=O.
What is the InChIKey of 4,4-dimethyl-2-[(3-methylpiperidin-2-yl)methyl]-1,1-dioxothiazetidin-3-one?
The InChIKey is KRCONVBMZNXNNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3S/c1-8-5-4-6-12-9(8)7-13-10(14)11(2,3)17(13,15)16/h8-9,12H,4-7H2,1-3H3.
What are the key properties of 4,4-dimethyl-2-[(3-methylpiperidin-2-yl)methyl]-1,1-dioxothiazetidin-3-one?
4,4-dimethyl-2-[(3-methylpiperidin-2-yl)methyl]-1,1-dioxothiazetidin-3-one has a molecular weight of 260.36 g/mol, XLogP of 0.33, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2-[(3-methylpiperidin-2-yl)methyl]-1,1-dioxothiazetidin-3-one is sourced from PubChem (CID 79875634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).