About 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile
1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 79875756) has the molecular formula C11H10N4O2S
and a molecular weight of 262.29 g/mol. Its IUPAC name is 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile |
| PubChem CID | 79875756 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | CCc1nc(-n2cc(C#N)c(=O)[nH]c2=O)sc1C |
| InChI | InChI=1S/C11H10N4O2S/c1-3-8-6(2)18-11(13-8)15-5-7(4-12)9(16)14-10(15)17/h5H,3H2,1-2H3,(H,14,16,17) |
| InChIKey | PASRWJWVILKYRL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile?
The IUPAC name of 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile (CID 79875756) is 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile.
What is the SMILES notation for 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile?
The canonical SMILES for 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile is CCc1nc(-n2cc(C#N)c(=O)[nH]c2=O)sc1C.
What is the InChIKey of 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile?
The InChIKey is PASRWJWVILKYRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O2S/c1-3-8-6(2)18-11(13-8)15-5-7(4-12)9(16)14-10(15)17/h5H,3H2,1-2H3,(H,14,16,17).
What are the key properties of 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile?
1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile has a molecular weight of 262.29 g/mol, XLogP of 0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile is sourced from PubChem (CID 79875756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).