About 1-(4-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile
1-(4-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 79875758) has the molecular formula C12H12N4O2S
and a molecular weight of 276.32 g/mol. Its IUPAC name is 1-(4-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile |
| PubChem CID | 79875758 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | CC(C)(C)c1csc(-n2cc(C#N)c(=O)[nH]c2=O)n1 |
| InChI | InChI=1S/C12H12N4O2S/c1-12(2,3)8-6-19-11(14-8)16-5-7(4-13)9(17)15-10(16)18/h5-6H,1-3H3,(H,15,17,18) |
| InChIKey | HQNALYIUUFXDGP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile?
The IUPAC name of 1-(4-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile (CID 79875758) is 1-(4-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile.
What is the SMILES notation for 1-(4-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile?
The canonical SMILES for 1-(4-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile is CC(C)(C)c1csc(-n2cc(C#N)c(=O)[nH]c2=O)n1.
What is the InChIKey of 1-(4-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile?
The InChIKey is HQNALYIUUFXDGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O2S/c1-12(2,3)8-6-19-11(14-8)16-5-7(4-13)9(17)15-10(16)18/h5-6H,1-3H3,(H,15,17,18).
What are the key properties of 1-(4-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile?
1-(4-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile has a molecular weight of 276.32 g/mol, XLogP of 1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-tert-butyl-1,3-thiazol-2-yl)-2,4-dioxopyrimidine-5-carbonitrile is sourced from PubChem (CID 79875758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).