C13H15F3N4O — CID 79875890
2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 79875890) has the molecular formula C13H15F3N4O and a molecular weight of 300.28 g/mol. Its IUPAC name is 2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 79875890 |
| Molecular Formula | C13H15F3N4O |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(C(F)(F)F)nc1N1CC2CNCC2C1 |
| InChI | InChI=1S/C13H15F3N4O/c14-13(15,16)10-2-1-9(11(17)21)12(19-10)20-5-7-3-18-4-8(7)6-20/h1-2,7-8,18H,3-6H2,(H2,17,21) |
| InChIKey | MGXFYQGLQVYKED-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |