C9H16N2O3S2 — CID 79876303
2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)-2-methylbutanethioamide (PubChem CID 79876303) has the molecular formula C9H16N2O3S2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)-2-methylbutanethioamide.
| Compound Name | 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)-2-methylbutanethioamide |
|---|---|
| PubChem CID | 79876303 |
| Molecular Formula | C9H16N2O3S2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)-2-methylbutanethioamide |
| SMILES | CCC(C)(C(N)=S)N1C(=O)C(C)(C)S1(=O)=O |
| InChI | InChI=1S/C9H16N2O3S2/c1-5-9(4,6(10)15)11-7(12)8(2,3)16(11,13)14/h5H2,1-4H3,(H2,10,15) |
| InChIKey | CKUBQOQKMRLQMY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|