C12H17N3O2 — CID 79876442
1-heptan-2-yl-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 79876442) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-heptan-2-yl-2,4-dioxopyrimidine-5-carbonitrile.
| Compound Name | 1-heptan-2-yl-2,4-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 79876442 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 1-heptan-2-yl-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | CCCCCC(C)n1cc(C#N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H17N3O2/c1-3-4-5-6-9(2)15-8-10(7-13)11(16)14-12(15)17/h8-9H,3-6H2,1-2H3,(H,14,16,17) |
| InChIKey | WNPNUXBBFUCMNN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|