About 2-(2,3-dihydroxypropylamino)-6-(trifluoromethyl)pyridine-3-carbonitrile
2-(2,3-dihydroxypropylamino)-6-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 79877007) has the molecular formula C10H10F3N3O2
and a molecular weight of 261.20 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylamino)-6-(trifluoromethyl)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-(2,3-dihydroxypropylamino)-6-(trifluoromethyl)pyridine-3-carbonitrile |
| PubChem CID | 79877007 |
| Molecular Formula | C10H10F3N3O2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-(2,3-dihydroxypropylamino)-6-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(C(F)(F)F)nc1NCC(O)CO |
| InChI | InChI=1S/C10H10F3N3O2/c11-10(12,13)8-2-1-6(3-14)9(16-8)15-4-7(18)5-17/h1-2,7,17-18H,4-5H2,(H,15,16) |
| InChIKey | PBTWGAGKLDXEMK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 89.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,3-dihydroxypropylamino)-6-(trifluoromethyl)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydroxypropylamino)-6-(trifluoromethyl)pyridine-3-carbonitrile?
The IUPAC name of 2-(2,3-dihydroxypropylamino)-6-(trifluoromethyl)pyridine-3-carbonitrile (CID 79877007) is 2-(2,3-dihydroxypropylamino)-6-(trifluoromethyl)pyridine-3-carbonitrile.
What is the SMILES notation for 2-(2,3-dihydroxypropylamino)-6-(trifluoromethyl)pyridine-3-carbonitrile?
The canonical SMILES for 2-(2,3-dihydroxypropylamino)-6-(trifluoromethyl)pyridine-3-carbonitrile is N#Cc1ccc(C(F)(F)F)nc1NCC(O)CO.
What is the InChIKey of 2-(2,3-dihydroxypropylamino)-6-(trifluoromethyl)pyridine-3-carbonitrile?
The InChIKey is PBTWGAGKLDXEMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3N3O2/c11-10(12,13)8-2-1-6(3-14)9(16-8)15-4-7(18)5-17/h1-2,7,17-18H,4-5H2,(H,15,16).
What are the key properties of 2-(2,3-dihydroxypropylamino)-6-(trifluoromethyl)pyridine-3-carbonitrile?
2-(2,3-dihydroxypropylamino)-6-(trifluoromethyl)pyridine-3-carbonitrile has a molecular weight of 261.20 g/mol, XLogP of 0.74, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydroxypropylamino)-6-(trifluoromethyl)pyridine-3-carbonitrile is sourced from PubChem (CID 79877007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).