C11H10F3N5S — CID 79877181
2-(3,5-dimethyl-1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyridine-3-carbothioamide (PubChem CID 79877181) has the molecular formula C11H10F3N5S and a molecular weight of 301.30 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyridine-3-carbothioamide.
| Compound Name | 2-(3,5-dimethyl-1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 79877181 |
| Molecular Formula | C11H10F3N5S |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2-(3,5-dimethyl-1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyridine-3-carbothioamide |
| SMILES | Cc1nc(C)n(-c2nc(C(F)(F)F)ccc2C(N)=S)n1 |
| InChI | InChI=1S/C11H10F3N5S/c1-5-16-6(2)19(18-5)10-7(9(15)20)3-4-8(17-10)11(12,13)14/h3-4H,1-2H3,(H2,15,20) |
| InChIKey | UUHDWQUKJZZANP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|