C10H8F6N2OS — CID 79877729
6-(trifluoromethyl)-2-(1,1,1-trifluoropropan-2-yloxy)pyridine-3-carbothioamide (PubChem CID 79877729) has the molecular formula C10H8F6N2OS and a molecular weight of 318.24 g/mol. Its IUPAC name is 6-(trifluoromethyl)-2-(1,1,1-trifluoropropan-2-yloxy)pyridine-3-carbothioamide.
| Compound Name | 6-(trifluoromethyl)-2-(1,1,1-trifluoropropan-2-yloxy)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 79877729 |
| Molecular Formula | C10H8F6N2OS |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 6-(trifluoromethyl)-2-(1,1,1-trifluoropropan-2-yloxy)pyridine-3-carbothioamide |
| SMILES | CC(Oc1nc(C(F)(F)F)ccc1C(N)=S)C(F)(F)F |
| InChI | InChI=1S/C10H8F6N2OS/c1-4(9(11,12)13)19-8-5(7(17)20)2-3-6(18-8)10(14,15)16/h2-4H,1H3,(H2,17,20) |
| InChIKey | QFTJCTWVCQEQHP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|