C15H18ClN3 — CID 79878389
3-chloro-4-(2,2-dimethylcyclopentyl)-5-phenyl-1,2,4-triazole (PubChem CID 79878389) has the molecular formula C15H18ClN3 and a molecular weight of 275.78 g/mol. Its IUPAC name is 3-chloro-4-(2,2-dimethylcyclopentyl)-5-phenyl-1,2,4-triazole.
| Compound Name | 3-chloro-4-(2,2-dimethylcyclopentyl)-5-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 79878389 |
| Molecular Formula | C15H18ClN3 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-chloro-4-(2,2-dimethylcyclopentyl)-5-phenyl-1,2,4-triazole |
| SMILES | CC1(C)CCCC1n1c(Cl)nnc1-c1ccccc1 |
| InChI | InChI=1S/C15H18ClN3/c1-15(2)10-6-9-12(15)19-13(17-18-14(19)16)11-7-4-3-5-8-11/h3-5,7-8,12H,6,9-10H2,1-2H3 |
| InChIKey | XAUPNKXSFJUHRQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |