About 1-prop-2-ynylidene-2,3-dihydroinden-5-amine
1-prop-2-ynylidene-2,3-dihydroinden-5-amine (PubChem CID 79879291) has the molecular formula C12H11N
and a molecular weight of 169.23 g/mol. Its IUPAC name is 1-prop-2-ynylidene-2,3-dihydroinden-5-amine.
Molecular Properties
| Compound Name | 1-prop-2-ynylidene-2,3-dihydroinden-5-amine |
| PubChem CID | 79879291 |
| Molecular Formula | C12H11N |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 1-prop-2-ynylidene-2,3-dihydroinden-5-amine |
| SMILES | C#CC=C1CCc2cc(N)ccc21 |
| InChI | InChI=1S/C12H11N/c1-2-3-9-4-5-10-8-11(13)6-7-12(9)10/h1,3,6-8H,4-5,13H2 |
| InChIKey | XPAVROKLBFZLJL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-ynylidene-2,3-dihydroinden-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-ynylidene-2,3-dihydroinden-5-amine?
The IUPAC name of 1-prop-2-ynylidene-2,3-dihydroinden-5-amine (CID 79879291) is 1-prop-2-ynylidene-2,3-dihydroinden-5-amine.
What is the SMILES notation for 1-prop-2-ynylidene-2,3-dihydroinden-5-amine?
The canonical SMILES for 1-prop-2-ynylidene-2,3-dihydroinden-5-amine is C#CC=C1CCc2cc(N)ccc21.
What is the InChIKey of 1-prop-2-ynylidene-2,3-dihydroinden-5-amine?
The InChIKey is XPAVROKLBFZLJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N/c1-2-3-9-4-5-10-8-11(13)6-7-12(9)10/h1,3,6-8H,4-5,13H2.
What are the key properties of 1-prop-2-ynylidene-2,3-dihydroinden-5-amine?
1-prop-2-ynylidene-2,3-dihydroinden-5-amine has a molecular weight of 169.23 g/mol, XLogP of 2.23, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-ynylidene-2,3-dihydroinden-5-amine is sourced from PubChem (CID 79879291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).