About 1-[(3,5-dimethylphenyl)methylidene]-2,3-dihydroinden-5-amine
1-[(3,5-dimethylphenyl)methylidene]-2,3-dihydroinden-5-amine (PubChem CID 79880127) has the molecular formula C18H19N
and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-[(3,5-dimethylphenyl)methylidene]-2,3-dihydroinden-5-amine.
Molecular Properties
| Compound Name | 1-[(3,5-dimethylphenyl)methylidene]-2,3-dihydroinden-5-amine |
| PubChem CID | 79880127 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-[(3,5-dimethylphenyl)methylidene]-2,3-dihydroinden-5-amine |
| SMILES | Cc1cc(C)cc(C=C2CCc3cc(N)ccc32)c1 |
| InChI | InChI=1S/C18H19N/c1-12-7-13(2)9-14(8-12)10-15-3-4-16-11-17(19)5-6-18(15)16/h5-11H,3-4,19H2,1-2H3 |
| InChIKey | ULWGRWSTUNETHM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,5-dimethylphenyl)methylidene]-2,3-dihydroinden-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dimethylphenyl)methylidene]-2,3-dihydroinden-5-amine?
The IUPAC name of 1-[(3,5-dimethylphenyl)methylidene]-2,3-dihydroinden-5-amine (CID 79880127) is 1-[(3,5-dimethylphenyl)methylidene]-2,3-dihydroinden-5-amine.
What is the SMILES notation for 1-[(3,5-dimethylphenyl)methylidene]-2,3-dihydroinden-5-amine?
The canonical SMILES for 1-[(3,5-dimethylphenyl)methylidene]-2,3-dihydroinden-5-amine is Cc1cc(C)cc(C=C2CCc3cc(N)ccc32)c1.
What is the InChIKey of 1-[(3,5-dimethylphenyl)methylidene]-2,3-dihydroinden-5-amine?
The InChIKey is ULWGRWSTUNETHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N/c1-12-7-13(2)9-14(8-12)10-15-3-4-16-11-17(19)5-6-18(15)16/h5-11H,3-4,19H2,1-2H3.
What are the key properties of 1-[(3,5-dimethylphenyl)methylidene]-2,3-dihydroinden-5-amine?
1-[(3,5-dimethylphenyl)methylidene]-2,3-dihydroinden-5-amine has a molecular weight of 249.36 g/mol, XLogP of 4.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dimethylphenyl)methylidene]-2,3-dihydroinden-5-amine is sourced from PubChem (CID 79880127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).