About 2-(1H-1,2,4-triazol-5-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid
2-(1H-1,2,4-triazol-5-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid (PubChem CID 79880172) has the molecular formula C9H5F3N4O2S
and a molecular weight of 290.23 g/mol. Its IUPAC name is 2-(1H-1,2,4-triazol-5-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-(1H-1,2,4-triazol-5-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid |
| PubChem CID | 79880172 |
| Molecular Formula | C9H5F3N4O2S |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 2-(1H-1,2,4-triazol-5-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(F)(F)F)nc1Sc1ncn[nH]1 |
| InChI | InChI=1S/C9H5F3N4O2S/c10-9(11,12)5-2-1-4(7(17)18)6(15-5)19-8-13-3-14-16-8/h1-3H,(H,17,18)(H,13,14,16) |
| InChIKey | KIFRVGPOQYMGPE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1H-1,2,4-triazol-5-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-1,2,4-triazol-5-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid?
The IUPAC name of 2-(1H-1,2,4-triazol-5-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid (CID 79880172) is 2-(1H-1,2,4-triazol-5-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid.
What is the SMILES notation for 2-(1H-1,2,4-triazol-5-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid?
The canonical SMILES for 2-(1H-1,2,4-triazol-5-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid is O=C(O)c1ccc(C(F)(F)F)nc1Sc1ncn[nH]1.
What is the InChIKey of 2-(1H-1,2,4-triazol-5-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid?
The InChIKey is KIFRVGPOQYMGPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F3N4O2S/c10-9(11,12)5-2-1-4(7(17)18)6(15-5)19-8-13-3-14-16-8/h1-3H,(H,17,18)(H,13,14,16).
What are the key properties of 2-(1H-1,2,4-triazol-5-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid?
2-(1H-1,2,4-triazol-5-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid has a molecular weight of 290.23 g/mol, XLogP of 2.07, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-1,2,4-triazol-5-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxylic acid is sourced from PubChem (CID 79880172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).