C11H16N4O2 — CID 79880596
5-(4-amino-3-methylpiperidine-1-carbonyl)-1H-pyrazin-2-one (PubChem CID 79880596) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 5-(4-amino-3-methylpiperidine-1-carbonyl)-1H-pyrazin-2-one.
| Compound Name | 5-(4-amino-3-methylpiperidine-1-carbonyl)-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 79880596 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 5-(4-amino-3-methylpiperidine-1-carbonyl)-1H-pyrazin-2-one |
| SMILES | CC1CN(C(=O)c2c[nH]c(=O)cn2)CCC1N |
| InChI | InChI=1S/C11H16N4O2/c1-7-6-15(3-2-8(7)12)11(17)9-4-14-10(16)5-13-9/h4-5,7-8H,2-3,6,12H2,1H3,(H,14,16) |
| InChIKey | MUYWNCQAPBOWGB-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |