C14H11F4NO2 — CID 79881310
4-[[2-(difluoromethoxy)anilino]methyl]-2,6-difluorophenol (PubChem CID 79881310) has the molecular formula C14H11F4NO2 and a molecular weight of 301.24 g/mol. Its IUPAC name is 4-[[2-(difluoromethoxy)anilino]methyl]-2,6-difluorophenol.
| Compound Name | 4-[[2-(difluoromethoxy)anilino]methyl]-2,6-difluorophenol |
|---|---|
| PubChem CID | 79881310 |
| Molecular Formula | C14H11F4NO2 |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 4-[[2-(difluoromethoxy)anilino]methyl]-2,6-difluorophenol |
| SMILES | Oc1c(F)cc(CNc2ccccc2OC(F)F)cc1F |
| InChI | InChI=1S/C14H11F4NO2/c15-9-5-8(6-10(16)13(9)20)7-19-11-3-1-2-4-12(11)21-14(17)18/h1-6,14,19-20H,7H2 |
| InChIKey | CXELMQMAWPQFQG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |