C13H10F2N2O4 — CID 79881574
3-[3,5-difluoro-4-[(5-methyl-1,3,4-oxadiazol-2-yl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 79881574) has the molecular formula C13H10F2N2O4 and a molecular weight of 296.23 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-[(5-methyl-1,3,4-oxadiazol-2-yl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3,5-difluoro-4-[(5-methyl-1,3,4-oxadiazol-2-yl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 79881574 |
| Molecular Formula | C13H10F2N2O4 |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 3-[3,5-difluoro-4-[(5-methyl-1,3,4-oxadiazol-2-yl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | Cc1nnc(COc2c(F)cc(C=CC(=O)O)cc2F)o1 |
| InChI | InChI=1S/C13H10F2N2O4/c1-7-16-17-11(21-7)6-20-13-9(14)4-8(5-10(13)15)2-3-12(18)19/h2-5H,6H2,1H3,(H,18,19) |
| InChIKey | ICASNVGQSSZVJY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|