C14H17F2N3O2 — CID 79882758
N-[[3,5-difluoro-4-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]phenyl]methyl]propan-1-amine (PubChem CID 79882758) has the molecular formula C14H17F2N3O2 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-[[3,5-difluoro-4-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]phenyl]methyl]propan-1-amine.
| Compound Name | N-[[3,5-difluoro-4-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 79882758 |
| Molecular Formula | C14H17F2N3O2 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N-[[3,5-difluoro-4-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(F)c(OCc2nonc2C)c(F)c1 |
| InChI | InChI=1S/C14H17F2N3O2/c1-3-4-17-7-10-5-11(15)14(12(16)6-10)20-8-13-9(2)18-21-19-13/h5-6,17H,3-4,7-8H2,1-2H3 |
| InChIKey | LYQYDYKGLFXIEL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|