About 2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-6-amine
2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-6-amine (PubChem CID 79883035) has the molecular formula C16H14N4O
and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-6-amine.
Molecular Properties
| Compound Name | 2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-6-amine |
| PubChem CID | 79883035 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-6-amine |
| SMILES | Cc1cc2ncn(-c3nc4ccc(N)cc4o3)c2cc1C |
| InChI | InChI=1S/C16H14N4O/c1-9-5-13-14(6-10(9)2)20(8-18-13)16-19-12-4-3-11(17)7-15(12)21-16/h3-8H,17H2,1-2H3 |
| InChIKey | XXGGJSROWQRXAP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-6-amine?
The IUPAC name of 2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-6-amine (CID 79883035) is 2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-6-amine.
What is the SMILES notation for 2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-6-amine?
The canonical SMILES for 2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-6-amine is Cc1cc2ncn(-c3nc4ccc(N)cc4o3)c2cc1C.
What is the InChIKey of 2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-6-amine?
The InChIKey is XXGGJSROWQRXAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O/c1-9-5-13-14(6-10(9)2)20(8-18-13)16-19-12-4-3-11(17)7-15(12)21-16/h3-8H,17H2,1-2H3.
What are the key properties of 2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-6-amine?
2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-6-amine has a molecular weight of 278.31 g/mol, XLogP of 3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-6-amine is sourced from PubChem (CID 79883035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).