C21H22N2O2S — CID 7988392
(5S)-5-(2,3-dihydro-1H-inden-5-yl)-5-methyl-3-[(4-methylsulfanylphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 7988392) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is (5S)-5-(2,3-dihydro-1H-inden-5-yl)-5-methyl-3-[(4-methylsulfanylphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(2,3-dihydro-1H-inden-5-yl)-5-methyl-3-[(4-methylsulfanylphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7988392 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (5S)-5-(2,3-dihydro-1H-inden-5-yl)-5-methyl-3-[(4-methylsulfanylphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | CSc1ccc(CN2C(=O)N[C@@](C)(c3ccc4c(c3)CCC4)C2=O)cc1 |
| InChI | InChI=1S/C21H22N2O2S/c1-21(17-9-8-15-4-3-5-16(15)12-17)19(24)23(20(25)22-21)13-14-6-10-18(26-2)11-7-14/h6-12H,3-5,13H2,1-2H3,(H,22,25)/t21-/m0/s1 |
| InChIKey | GQEBIAUPGCPVOP-NRFANRHFSA-N |
| XLogP | 3.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|