About 2-butan-2-ylsulfanyl-1,3-benzoxazol-4-amine
2-butan-2-ylsulfanyl-1,3-benzoxazol-4-amine (PubChem CID 79884155) has the molecular formula C11H14N2OS
and a molecular weight of 222.31 g/mol. Its IUPAC name is 2-butan-2-ylsulfanyl-1,3-benzoxazol-4-amine.
Molecular Properties
| Compound Name | 2-butan-2-ylsulfanyl-1,3-benzoxazol-4-amine |
| PubChem CID | 79884155 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-butan-2-ylsulfanyl-1,3-benzoxazol-4-amine |
| SMILES | CCC(C)Sc1nc2c(N)cccc2o1 |
| InChI | InChI=1S/C11H14N2OS/c1-3-7(2)15-11-13-10-8(12)5-4-6-9(10)14-11/h4-7H,3,12H2,1-2H3 |
| InChIKey | LMMWJFZMTQNSCK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-butan-2-ylsulfanyl-1,3-benzoxazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-ylsulfanyl-1,3-benzoxazol-4-amine?
The IUPAC name of 2-butan-2-ylsulfanyl-1,3-benzoxazol-4-amine (CID 79884155) is 2-butan-2-ylsulfanyl-1,3-benzoxazol-4-amine.
What is the SMILES notation for 2-butan-2-ylsulfanyl-1,3-benzoxazol-4-amine?
The canonical SMILES for 2-butan-2-ylsulfanyl-1,3-benzoxazol-4-amine is CCC(C)Sc1nc2c(N)cccc2o1.
What is the InChIKey of 2-butan-2-ylsulfanyl-1,3-benzoxazol-4-amine?
The InChIKey is LMMWJFZMTQNSCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2OS/c1-3-7(2)15-11-13-10-8(12)5-4-6-9(10)14-11/h4-7H,3,12H2,1-2H3.
What are the key properties of 2-butan-2-ylsulfanyl-1,3-benzoxazol-4-amine?
2-butan-2-ylsulfanyl-1,3-benzoxazol-4-amine has a molecular weight of 222.31 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-ylsulfanyl-1,3-benzoxazol-4-amine is sourced from PubChem (CID 79884155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).