C15H17F2NO3 — CID 79884292
N-cyclopentyl-2-(2,6-difluoro-4-formylphenoxy)propanamide (PubChem CID 79884292) has the molecular formula C15H17F2NO3 and a molecular weight of 297.30 g/mol. Its IUPAC name is N-cyclopentyl-2-(2,6-difluoro-4-formylphenoxy)propanamide.
| Compound Name | N-cyclopentyl-2-(2,6-difluoro-4-formylphenoxy)propanamide |
|---|---|
| PubChem CID | 79884292 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-cyclopentyl-2-(2,6-difluoro-4-formylphenoxy)propanamide |
| SMILES | CC(Oc1c(F)cc(C=O)cc1F)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H17F2NO3/c1-9(15(20)18-11-4-2-3-5-11)21-14-12(16)6-10(8-19)7-13(14)17/h6-9,11H,2-5H2,1H3,(H,18,20) |
| InChIKey | AXPDHBWTJUCYMY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|