About 1-(1-amino-4-methylpentan-2-yl)-2,6-dimethylpyridin-4-one
1-(1-amino-4-methylpentan-2-yl)-2,6-dimethylpyridin-4-one (PubChem CID 79884850) has the molecular formula C13H22N2O
and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(1-amino-4-methylpentan-2-yl)-2,6-dimethylpyridin-4-one.
Molecular Properties
| Compound Name | 1-(1-amino-4-methylpentan-2-yl)-2,6-dimethylpyridin-4-one |
| PubChem CID | 79884850 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-(1-amino-4-methylpentan-2-yl)-2,6-dimethylpyridin-4-one |
| SMILES | Cc1cc(=O)cc(C)n1C(CN)CC(C)C |
| InChI | InChI=1S/C13H22N2O/c1-9(2)5-12(8-14)15-10(3)6-13(16)7-11(15)4/h6-7,9,12H,5,8,14H2,1-4H3 |
| InChIKey | ZVRRMXOGBLICMB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1-amino-4-methylpentan-2-yl)-2,6-dimethylpyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-amino-4-methylpentan-2-yl)-2,6-dimethylpyridin-4-one?
The IUPAC name of 1-(1-amino-4-methylpentan-2-yl)-2,6-dimethylpyridin-4-one (CID 79884850) is 1-(1-amino-4-methylpentan-2-yl)-2,6-dimethylpyridin-4-one.
What is the SMILES notation for 1-(1-amino-4-methylpentan-2-yl)-2,6-dimethylpyridin-4-one?
The canonical SMILES for 1-(1-amino-4-methylpentan-2-yl)-2,6-dimethylpyridin-4-one is Cc1cc(=O)cc(C)n1C(CN)CC(C)C.
What is the InChIKey of 1-(1-amino-4-methylpentan-2-yl)-2,6-dimethylpyridin-4-one?
The InChIKey is ZVRRMXOGBLICMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O/c1-9(2)5-12(8-14)15-10(3)6-13(16)7-11(15)4/h6-7,9,12H,5,8,14H2,1-4H3.
What are the key properties of 1-(1-amino-4-methylpentan-2-yl)-2,6-dimethylpyridin-4-one?
1-(1-amino-4-methylpentan-2-yl)-2,6-dimethylpyridin-4-one has a molecular weight of 222.33 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-amino-4-methylpentan-2-yl)-2,6-dimethylpyridin-4-one is sourced from PubChem (CID 79884850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).