About 1-(1,3-dihydroxypropan-2-yl)-2,6-dimethylpyridin-4-one
1-(1,3-dihydroxypropan-2-yl)-2,6-dimethylpyridin-4-one (PubChem CID 79884865) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is 1-(1,3-dihydroxypropan-2-yl)-2,6-dimethylpyridin-4-one.
Molecular Properties
| Compound Name | 1-(1,3-dihydroxypropan-2-yl)-2,6-dimethylpyridin-4-one |
| PubChem CID | 79884865 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 1-(1,3-dihydroxypropan-2-yl)-2,6-dimethylpyridin-4-one |
| SMILES | Cc1cc(=O)cc(C)n1C(CO)CO |
| InChI | InChI=1S/C10H15NO3/c1-7-3-10(14)4-8(2)11(7)9(5-12)6-13/h3-4,9,12-13H,5-6H2,1-2H3 |
| InChIKey | SMZHDHZQFTVOLG-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,3-dihydroxypropan-2-yl)-2,6-dimethylpyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dihydroxypropan-2-yl)-2,6-dimethylpyridin-4-one?
The IUPAC name of 1-(1,3-dihydroxypropan-2-yl)-2,6-dimethylpyridin-4-one (CID 79884865) is 1-(1,3-dihydroxypropan-2-yl)-2,6-dimethylpyridin-4-one.
What is the SMILES notation for 1-(1,3-dihydroxypropan-2-yl)-2,6-dimethylpyridin-4-one?
The canonical SMILES for 1-(1,3-dihydroxypropan-2-yl)-2,6-dimethylpyridin-4-one is Cc1cc(=O)cc(C)n1C(CO)CO.
What is the InChIKey of 1-(1,3-dihydroxypropan-2-yl)-2,6-dimethylpyridin-4-one?
The InChIKey is SMZHDHZQFTVOLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-7-3-10(14)4-8(2)11(7)9(5-12)6-13/h3-4,9,12-13H,5-6H2,1-2H3.
What are the key properties of 1-(1,3-dihydroxypropan-2-yl)-2,6-dimethylpyridin-4-one?
1-(1,3-dihydroxypropan-2-yl)-2,6-dimethylpyridin-4-one has a molecular weight of 197.23 g/mol, XLogP of -0.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dihydroxypropan-2-yl)-2,6-dimethylpyridin-4-one is sourced from PubChem (CID 79884865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).